C32H37NOS2 — CID 134930065
(1S,2S)-1-naphthalen-2-yl-2-pyridin-2-ylsulfanyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethanol (PubChem CID 134930065) has the molecular formula C32H37NOS2 and a molecular weight of 515.79 g/mol. Its IUPAC name is (1S,2S)-1-naphthalen-2-yl-2-pyridin-2-ylsulfanyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethanol.
| Compound Name | (1S,2S)-1-naphthalen-2-yl-2-pyridin-2-ylsulfanyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethanol |
|---|---|
| PubChem CID | 134930065 |
| Molecular Formula | C32H37NOS2 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (1S,2S)-1-naphthalen-2-yl-2-pyridin-2-ylsulfanyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfanylethanol |
| SMILES | CC(C)c1cc(C(C)C)c(S[C@@H](Sc2ccccn2)[C@@H](O)c2ccc3ccccc3c2)c(C(C)C)c1 |
| InChI | InChI=1S/C32H37NOS2/c1-20(2)26-18-27(21(3)4)31(28(19-26)22(5)6)36-32(35-29-13-9-10-16-33-29)30(34)25-15-14-23-11-7-8-12-24(23)17-25/h7-22,30,32,34H,1-6H3/t30-,32+/m0/s1 |
| InChIKey | YQLOVDUASMIPEC-XDFJSJKPSA-N |
| XLogP | 9.55 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|