C21H23NOS2 — CID 134929230
(1S,2S)-2-tert-butylsulfanyl-1-naphthalen-2-yl-2-pyridin-2-ylsulfanylethanol (PubChem CID 134929230) has the molecular formula C21H23NOS2 and a molecular weight of 369.56 g/mol. Its IUPAC name is (1S,2S)-2-tert-butylsulfanyl-1-naphthalen-2-yl-2-pyridin-2-ylsulfanylethanol.
| Compound Name | (1S,2S)-2-tert-butylsulfanyl-1-naphthalen-2-yl-2-pyridin-2-ylsulfanylethanol |
|---|---|
| PubChem CID | 134929230 |
| Molecular Formula | C21H23NOS2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | (1S,2S)-2-tert-butylsulfanyl-1-naphthalen-2-yl-2-pyridin-2-ylsulfanylethanol |
| SMILES | CC(C)(C)S[C@@H](Sc1ccccn1)[C@@H](O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H23NOS2/c1-21(2,3)25-20(24-18-10-6-7-13-22-18)19(23)17-12-11-15-8-4-5-9-16(15)14-17/h4-14,19-20,23H,1-3H3/t19-,20+/m0/s1 |
| InChIKey | XURUSIKATRWYIU-VQTJNVASSA-N |
| XLogP | 5.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|