C17H27NOS2 — CID 134930390
(1S,2S)-2-tert-butylsulfanyl-1-cyclohexyl-2-pyridin-2-ylsulfanylethanol (PubChem CID 134930390) has the molecular formula C17H27NOS2 and a molecular weight of 325.54 g/mol. Its IUPAC name is (1S,2S)-2-tert-butylsulfanyl-1-cyclohexyl-2-pyridin-2-ylsulfanylethanol.
| Compound Name | (1S,2S)-2-tert-butylsulfanyl-1-cyclohexyl-2-pyridin-2-ylsulfanylethanol |
|---|---|
| PubChem CID | 134930390 |
| Molecular Formula | C17H27NOS2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | (1S,2S)-2-tert-butylsulfanyl-1-cyclohexyl-2-pyridin-2-ylsulfanylethanol |
| SMILES | CC(C)(C)SC(Sc1ccccn1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C17H27NOS2/c1-17(2,3)21-16(20-14-11-7-8-12-18-14)15(19)13-9-5-4-6-10-13/h7-8,11-13,15-16,19H,4-6,9-10H2,1-3H3/t15-,16?/m0/s1 |
| InChIKey | MJCFCMGDCVPIDH-VYRBHSGPSA-N |
| XLogP | 4.97 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|