C17H17FO2S — CID 64636487
2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanone (PubChem CID 64636487) has the molecular formula C17H17FO2S and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 64636487 |
| Molecular Formula | C17H17FO2S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)CS(=O)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H17FO2S/c1-11-8-12(2)17(13(3)9-11)16(19)10-21(20)15-6-4-14(18)5-7-15/h4-9H,10H2,1-3H3 |
| InChIKey | SJZHJRFNZGZLME-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |