C17H20FNOS — CID 64658479
2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanamine (PubChem CID 64658479) has the molecular formula C17H20FNOS and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanamine.
| Compound Name | 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 64658479 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(4-fluorophenyl)sulfinyl-1-(2,4,6-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(C(N)CS(=O)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H20FNOS/c1-11-8-12(2)17(13(3)9-11)16(19)10-21(20)15-6-4-14(18)5-7-15/h4-9,16H,10,19H2,1-3H3 |
| InChIKey | HAJOCQOGKAHZRG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |