C14H20O — CID 142839370
2,4-dimethylphenol;(2Z,4Z)-hexa-2,4-diene (PubChem CID 142839370) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 2,4-dimethylphenol;(2Z,4Z)-hexa-2,4-diene.
| Compound Name | 2,4-dimethylphenol;(2Z,4Z)-hexa-2,4-diene |
|---|---|
| PubChem CID | 142839370 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2,4-dimethylphenol;(2Z,4Z)-hexa-2,4-diene |
| SMILES | C/C=C\C=C/C.Cc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C8H10O.C6H10/c1-6-3-4-8(9)7(2)5-6;1-3-5-6-4-2/h3-5,9H,1-2H3;3-6H,1-2H3/b;5-3-,6-4- |
| InChIKey | MMUVWRHAGGVKRI-NFAXKJQBSA-N |
| XLogP | 4.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|