C13H21NO — CID 171834752
2,4-dimethylphenol;1-methylpyrrolidine (PubChem CID 171834752) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2,4-dimethylphenol;1-methylpyrrolidine.
| Compound Name | 2,4-dimethylphenol;1-methylpyrrolidine |
|---|---|
| PubChem CID | 171834752 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2,4-dimethylphenol;1-methylpyrrolidine |
| SMILES | CN1CCCC1.Cc1ccc(O)c(C)c1 |
| InChI | InChI=1S/C8H10O.C5H11N/c1-6-3-4-8(9)7(2)5-6;1-6-4-2-3-5-6/h3-5,9H,1-2H3;2-5H2,1H3 |
| InChIKey | VKLJWAMJSVGLCO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |