C13H15NO — CID 174895721
2,3-dimethylphenol;pyridine (PubChem CID 174895721) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2,3-dimethylphenol;pyridine.
| Compound Name | 2,3-dimethylphenol;pyridine |
|---|---|
| PubChem CID | 174895721 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,3-dimethylphenol;pyridine |
| SMILES | Cc1cccc(O)c1C.c1ccncc1 |
| InChI | InChI=1S/C8H10O.C5H5N/c1-6-4-3-5-8(9)7(6)2;1-2-4-6-5-3-1/h3-5,9H,1-2H3;1-5H |
| InChIKey | USCKONPHOKWESN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |