C25H34Cl3N — CID 163597059
1-chloro-3-cyclohexyl-2-methylbenzene;4-(3-chloro-2-methylphenyl)piperidine;hydrochloride (PubChem CID 163597059) has the molecular formula C25H34Cl3N and a molecular weight of 454.91 g/mol. Its IUPAC name is 1-chloro-3-cyclohexyl-2-methylbenzene;4-(3-chloro-2-methylphenyl)piperidine;hydrochloride.
| Compound Name | 1-chloro-3-cyclohexyl-2-methylbenzene;4-(3-chloro-2-methylphenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 163597059 |
| Molecular Formula | C25H34Cl3N |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 1-chloro-3-cyclohexyl-2-methylbenzene;4-(3-chloro-2-methylphenyl)piperidine;hydrochloride |
| SMILES | Cc1c(Cl)cccc1C1CCCCC1.Cc1c(Cl)cccc1C1CCNCC1.Cl |
| InChI | InChI=1S/C13H17Cl.C12H16ClN.ClH/c1-10-12(8-5-9-13(10)14)11-6-3-2-4-7-11;1-9-11(3-2-4-12(9)13)10-5-7-14-8-6-10;/h5,8-9,11H,2-4,6-7H2,1H3;2-4,10,14H,5-8H2,1H3;1H |
| InChIKey | RJKHHCXSXNYGOW-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |