C8H8N4O3S — CID 138811069
5-(2-hydroxy-3-nitrophenyl)-1,2,4-triazolidine-3-thione (PubChem CID 138811069) has the molecular formula C8H8N4O3S and a molecular weight of 240.24 g/mol. Its IUPAC name is 5-(2-hydroxy-3-nitrophenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5-(2-hydroxy-3-nitrophenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 138811069 |
| Molecular Formula | C8H8N4O3S |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 5-(2-hydroxy-3-nitrophenyl)-1,2,4-triazolidine-3-thione |
| SMILES | O=[N+]([O-])c1cccc(C2NNC(=S)N2)c1O |
| InChI | InChI=1S/C8H8N4O3S/c13-6-4(7-9-8(16)11-10-7)2-1-3-5(6)12(14)15/h1-3,7,10,13H,(H2,9,11,16) |
| InChIKey | APHSXWSUDCTIAB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|