C8H8N4O2S — CID 78348781
5-(4-nitrophenyl)-1,2,4-triazolidine-3-thione (PubChem CID 78348781) has the molecular formula C8H8N4O2S and a molecular weight of 224.25 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-1,2,4-triazolidine-3-thione.
| Compound Name | 5-(4-nitrophenyl)-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 78348781 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5-(4-nitrophenyl)-1,2,4-triazolidine-3-thione |
| SMILES | O=[N+]([O-])c1ccc(C2NNC(=S)N2)cc1 |
| InChI | InChI=1S/C8H8N4O2S/c13-12(14)6-3-1-5(2-4-6)7-9-8(15)11-10-7/h1-4,7,10H,(H2,9,11,15) |
| InChIKey | RLWKWRUXMGLDJE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|