C8H7N3O2S2 — CID 3855173
5-(4-nitrophenyl)-1,3,4-thiadiazolidine-2-thione (PubChem CID 3855173) has the molecular formula C8H7N3O2S2 and a molecular weight of 241.30 g/mol. Its IUPAC name is 5-(4-nitrophenyl)-1,3,4-thiadiazolidine-2-thione.
| Compound Name | 5-(4-nitrophenyl)-1,3,4-thiadiazolidine-2-thione |
|---|---|
| PubChem CID | 3855173 |
| Molecular Formula | C8H7N3O2S2 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 5-(4-nitrophenyl)-1,3,4-thiadiazolidine-2-thione |
| SMILES | O=[N+]([O-])c1ccc(C2NNC(=S)S2)cc1 |
| InChI | InChI=1S/C8H7N3O2S2/c12-11(13)6-3-1-5(2-4-6)7-9-10-8(14)15-7/h1-4,7,9H,(H,10,14) |
| InChIKey | BHLDLMHHOBEPIL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|