About (2-hydroxy-6-nitrophenyl)mercury;hydrate
(2-hydroxy-6-nitrophenyl)mercury;hydrate (PubChem CID 21455177) has the molecular formula C6H6HgNO4
and a molecular weight of 356.71 g/mol. Its IUPAC name is (2-hydroxy-6-nitrophenyl)mercury;hydrate.
Molecular Properties
| Compound Name | (2-hydroxy-6-nitrophenyl)mercury;hydrate |
| PubChem CID | 21455177 |
| Molecular Formula | C6H6HgNO4 |
| Molecular Weight | 356.71 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (2-hydroxy-6-nitrophenyl)mercury;hydrate |
| SMILES | O.O=[N+]([O-])c1cccc(O)c1[Hg] |
| InChI | InChI=1S/C6H4NO3.Hg.H2O/c8-6-3-1-2-5(4-6)7(9)10;;/h1-3,8H;;1H2 |
| InChIKey | BHYXLGDUHRDSME-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.71 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-6-nitrophenyl)mercury;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-6-nitrophenyl)mercury;hydrate?
The IUPAC name of (2-hydroxy-6-nitrophenyl)mercury;hydrate (CID 21455177) is (2-hydroxy-6-nitrophenyl)mercury;hydrate.
What is the SMILES notation for (2-hydroxy-6-nitrophenyl)mercury;hydrate?
The canonical SMILES for (2-hydroxy-6-nitrophenyl)mercury;hydrate is O.O=[N+]([O-])c1cccc(O)c1[Hg].
What is the InChIKey of (2-hydroxy-6-nitrophenyl)mercury;hydrate?
The InChIKey is BHYXLGDUHRDSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4NO3.Hg.H2O/c8-6-3-1-2-5(4-6)7(9)10;;/h1-3,8H;;1H2.
What are the key properties of (2-hydroxy-6-nitrophenyl)mercury;hydrate?
(2-hydroxy-6-nitrophenyl)mercury;hydrate has a molecular weight of 356.71 g/mol, XLogP of -0.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-6-nitrophenyl)mercury;hydrate is sourced from PubChem (CID 21455177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).