C18H23BrN2O4S2 — CID 55742987
N-[(4-bromothiophen-2-yl)methyl]-3-(diethylsulfamoyl)-4-methoxy-N-methylbenzamide (PubChem CID 55742987) has the molecular formula C18H23BrN2O4S2 and a molecular weight of 475.43 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-3-(diethylsulfamoyl)-4-methoxy-N-methylbenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-3-(diethylsulfamoyl)-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 55742987 |
| Molecular Formula | C18H23BrN2O4S2 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-3-(diethylsulfamoyl)-4-methoxy-N-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(C)Cc2cc(Br)cs2)ccc1OC |
| InChI | InChI=1S/C18H23BrN2O4S2/c1-5-21(6-2)27(23,24)17-9-13(7-8-16(17)25-4)18(22)20(3)11-15-10-14(19)12-26-15/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | RGQBHYDYAJMFTQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |