C20H34N2O4S — CID 55601920
3-(diethylsulfamoyl)-4-methoxy-N-pentyl-N-propan-2-ylbenzamide (PubChem CID 55601920) has the molecular formula C20H34N2O4S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-4-methoxy-N-pentyl-N-propan-2-ylbenzamide.
| Compound Name | 3-(diethylsulfamoyl)-4-methoxy-N-pentyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55601920 |
| Molecular Formula | C20H34N2O4S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-(diethylsulfamoyl)-4-methoxy-N-pentyl-N-propan-2-ylbenzamide |
| SMILES | CCCCCN(C(=O)c1ccc(OC)c(S(=O)(=O)N(CC)CC)c1)C(C)C |
| InChI | InChI=1S/C20H34N2O4S/c1-7-10-11-14-22(16(4)5)20(23)17-12-13-18(26-6)19(15-17)27(24,25)21(8-2)9-3/h12-13,15-16H,7-11,14H2,1-6H3 |
| InChIKey | BXMPCUJKFZEEOJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|