C23H26N2O2 — CID 18109898
N-[2-(dimethylamino)-3-phenylpropyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 18109898) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[2-(dimethylamino)-3-phenylpropyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[2-(dimethylamino)-3-phenylpropyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 18109898 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-[2-(dimethylamino)-3-phenylpropyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NCC(Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C23H26N2O2/c1-25(2)20(13-17-9-5-4-6-10-17)16-24-23(26)21-14-18-11-7-8-12-19(18)15-22(21)27-3/h4-12,14-15,20H,13,16H2,1-3H3,(H,24,26) |
| InChIKey | XGKPIDDWHJJWRM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |