C21H22N2O6S2 — CID 28557856
methyl 5-[[4-methoxy-3-(propylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 28557856) has the molecular formula C21H22N2O6S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is methyl 5-[[4-methoxy-3-(propylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 5-[[4-methoxy-3-(propylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 28557856 |
| Molecular Formula | C21H22N2O6S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | methyl 5-[[4-methoxy-3-(propylsulfamoyl)benzoyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | CCCNS(=O)(=O)c1cc(C(=O)Nc2ccc3sc(C(=O)OC)cc3c2)ccc1OC |
| InChI | InChI=1S/C21H22N2O6S2/c1-4-9-22-31(26,27)19-12-13(5-7-16(19)28-2)20(24)23-15-6-8-17-14(10-15)11-18(30-17)21(25)29-3/h5-8,10-12,22H,4,9H2,1-3H3,(H,23,24) |
| InChIKey | BSWOZSCWNNKZKX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |