C24H18F6N2O4 — CID 14100483
2,6-difluoro-N-[[3-methoxy-4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethoxy]phenyl]carbamoyl]benzamide (PubChem CID 14100483) has the molecular formula C24H18F6N2O4 and a molecular weight of 512.41 g/mol. Its IUPAC name is 2,6-difluoro-N-[[3-methoxy-4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethoxy]phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[3-methoxy-4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethoxy]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 14100483 |
| Molecular Formula | C24H18F6N2O4 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 2,6-difluoro-N-[[3-methoxy-4-[1,1,2,2-tetrafluoro-2-(4-methylphenyl)ethoxy]phenyl]carbamoyl]benzamide |
| SMILES | COc1cc(NC(=O)NC(=O)c2c(F)cccc2F)ccc1OC(F)(F)C(F)(F)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H18F6N2O4/c1-13-6-8-14(9-7-13)23(27,28)24(29,30)36-18-11-10-15(12-19(18)35-2)31-22(34)32-21(33)20-16(25)4-3-5-17(20)26/h3-12H,1-2H3,(H2,31,32,33,34) |
| InChIKey | YBGUMAREZWSBNH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|