C15H8F6N2O3 — CID 134104747
N-[[3-(difluoromethoxy)phenyl]carbamoyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 134104747) has the molecular formula C15H8F6N2O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]carbamoyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]carbamoyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 134104747 |
| Molecular Formula | C15H8F6N2O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]carbamoyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)c(F)cc(F)c1F)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H8F6N2O3/c16-8-5-9(17)12(19)10(11(8)18)13(24)23-15(25)22-6-2-1-3-7(4-6)26-14(20)21/h1-5,14H,(H2,22,23,24,25) |
| InChIKey | GBXZTBQNINTPTL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|