C23H20F2N2O3 — CID 70575675
2,6-difluoro-N-[[4-(1-phenylmethoxyethyl)phenyl]carbamoyl]benzamide (PubChem CID 70575675) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-(1-phenylmethoxyethyl)phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-(1-phenylmethoxyethyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 70575675 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 2,6-difluoro-N-[[4-(1-phenylmethoxyethyl)phenyl]carbamoyl]benzamide |
| SMILES | CC(OCc1ccccc1)c1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H20F2N2O3/c1-15(30-14-16-6-3-2-4-7-16)17-10-12-18(13-11-17)26-23(29)27-22(28)21-19(24)8-5-9-20(21)25/h2-13,15H,14H2,1H3,(H2,26,27,28,29) |
| InChIKey | YTUMNQISTZSJFD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |