C25H22ClF2N3O3 — CID 57320590
N-[[4-[[1-(4-chlorophenyl)but-1-enylamino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 57320590) has the molecular formula C25H22ClF2N3O3 and a molecular weight of 485.92 g/mol. Its IUPAC name is N-[[4-[[1-(4-chlorophenyl)but-1-enylamino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[4-[[1-(4-chlorophenyl)but-1-enylamino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 57320590 |
| Molecular Formula | C25H22ClF2N3O3 |
| Molecular Weight | 485.92 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[[4-[[1-(4-chlorophenyl)but-1-enylamino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | CCC=C(NOCc1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClF2N3O3/c1-2-4-22(17-9-11-18(26)12-10-17)31-34-15-16-7-13-19(14-8-16)29-25(33)30-24(32)23-20(27)5-3-6-21(23)28/h3-14,31H,2,15H2,1H3,(H2,29,30,32,33) |
| InChIKey | JLDJIJRKLWWROE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.92 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|