C25H20ClF2N3O3 — CID 56628540
N-[[4-[[[(4-chlorophenyl)-cyclopropylidenemethyl]amino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 56628540) has the molecular formula C25H20ClF2N3O3 and a molecular weight of 483.90 g/mol. Its IUPAC name is N-[[4-[[[(4-chlorophenyl)-cyclopropylidenemethyl]amino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[4-[[[(4-chlorophenyl)-cyclopropylidenemethyl]amino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 56628540 |
| Molecular Formula | C25H20ClF2N3O3 |
| Molecular Weight | 483.90 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[[4-[[[(4-chlorophenyl)-cyclopropylidenemethyl]amino]oxymethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(CONC(=C2CC2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H20ClF2N3O3/c26-18-10-8-17(9-11-18)23(16-6-7-16)31-34-14-15-4-12-19(13-5-15)29-25(33)30-24(32)22-20(27)2-1-3-21(22)28/h1-5,8-13,31H,6-7,14H2,(H2,29,30,32,33) |
| InChIKey | NPKFYYNSTHBNIO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.90 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|