C18H22N2O5S2 — CID 9042138
(2S)-2-(benzenesulfonamido)-N-(4-methylphenyl)-4-methylsulfonylbutanamide (PubChem CID 9042138) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-N-(4-methylphenyl)-4-methylsulfonylbutanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-N-(4-methylphenyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 9042138 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-N-(4-methylphenyl)-4-methylsulfonylbutanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](CCS(C)(=O)=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O5S2/c1-14-8-10-15(11-9-14)19-18(21)17(12-13-26(2,22)23)20-27(24,25)16-6-4-3-5-7-16/h3-11,17,20H,12-13H2,1-2H3,(H,19,21)/t17-/m0/s1 |
| InChIKey | RGVARXIAUXWHDV-KRWDZBQOSA-N |
| XLogP | 1.72 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |