C15H18N2O6S2 — CID 44609101
N-hydroxy-4-methylsulfonyl-2-(naphthalen-2-ylsulfonylamino)butanamide (PubChem CID 44609101) has the molecular formula C15H18N2O6S2 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-hydroxy-4-methylsulfonyl-2-(naphthalen-2-ylsulfonylamino)butanamide.
| Compound Name | N-hydroxy-4-methylsulfonyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 44609101 |
| Molecular Formula | C15H18N2O6S2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | N-hydroxy-4-methylsulfonyl-2-(naphthalen-2-ylsulfonylamino)butanamide |
| SMILES | CS(=O)(=O)CCC(NS(=O)(=O)c1ccc2ccccc2c1)C(=O)NO |
| InChI | InChI=1S/C15H18N2O6S2/c1-24(20,21)9-8-14(15(18)16-19)17-25(22,23)13-7-6-11-4-2-3-5-12(11)10-13/h2-7,10,14,17,19H,8-9H2,1H3,(H,16,18) |
| InChIKey | RUNPSSQRRVIPKB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|