C12H13N3O5S — CID 90948921
(2S)-N,3-dihydroxy-2-(quinolin-7-ylsulfonylamino)propanamide (PubChem CID 90948921) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is (2S)-N,3-dihydroxy-2-(quinolin-7-ylsulfonylamino)propanamide.
| Compound Name | (2S)-N,3-dihydroxy-2-(quinolin-7-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 90948921 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | (2S)-N,3-dihydroxy-2-(quinolin-7-ylsulfonylamino)propanamide |
| SMILES | O=C(NO)[C@H](CO)NS(=O)(=O)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C12H13N3O5S/c16-7-11(12(17)14-18)15-21(19,20)9-4-3-8-2-1-5-13-10(8)6-9/h1-6,11,15-16,18H,7H2,(H,14,17)/t11-/m0/s1 |
| InChIKey | NUAIYBYEOQLPOB-NSHDSACASA-N |
| XLogP | -0.62 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|