C20H16N2O4S2 — CID 23018513
3-(1-benzothiophen-3-yl)-2-(quinolin-6-ylsulfonylamino)propanoic acid (PubChem CID 23018513) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-2-(quinolin-6-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(1-benzothiophen-3-yl)-2-(quinolin-6-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 23018513 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-2-(quinolin-6-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)C(Cc1csc2ccccc12)NS(=O)(=O)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H16N2O4S2/c23-20(24)18(11-14-12-27-19-6-2-1-5-16(14)19)22-28(25,26)15-7-8-17-13(10-15)4-3-9-21-17/h1-10,12,18,22H,11H2,(H,23,24) |
| InChIKey | OUEMUNYURXMYKV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |