C31H28N2O4S2 — CID 10007892
N-benzhydryl-3-(1-benzothiophen-3-yl)-2-[(3-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 10007892) has the molecular formula C31H28N2O4S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-benzhydryl-3-(1-benzothiophen-3-yl)-2-[(3-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-benzhydryl-3-(1-benzothiophen-3-yl)-2-[(3-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 10007892 |
| Molecular Formula | C31H28N2O4S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-benzhydryl-3-(1-benzothiophen-3-yl)-2-[(3-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1cccc(S(=O)(=O)NC(Cc2csc3ccccc23)C(=O)NC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C31H28N2O4S2/c1-37-25-15-10-16-26(20-25)39(35,36)33-28(19-24-21-38-29-18-9-8-17-27(24)29)31(34)32-30(22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-18,20-21,28,30,33H,19H2,1H3,(H,32,34) |
| InChIKey | BMXOGJBUQJAUKA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |