C21H30N2O5S2 — CID 45353404
N-(1-adamantyl)-2-(benzenesulfonamido)-4-methylsulfonylbutanamide (PubChem CID 45353404) has the molecular formula C21H30N2O5S2 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(benzenesulfonamido)-4-methylsulfonylbutanamide.
| Compound Name | N-(1-adamantyl)-2-(benzenesulfonamido)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 45353404 |
| Molecular Formula | C21H30N2O5S2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | N-(1-adamantyl)-2-(benzenesulfonamido)-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(NS(=O)(=O)c1ccccc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N2O5S2/c1-29(25,26)8-7-19(23-30(27,28)18-5-3-2-4-6-18)20(24)22-21-12-15-9-16(13-21)11-17(10-15)14-21/h2-6,15-17,19,23H,7-14H2,1H3,(H,22,24) |
| InChIKey | RTQJCROYODRZBK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |