C23H34N2O3S2 — CID 112789579
N-[1-(1-adamantyl)ethyl]-2-(benzenesulfonamido)-4-methylsulfanylbutanamide (PubChem CID 112789579) has the molecular formula C23H34N2O3S2 and a molecular weight of 450.67 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(benzenesulfonamido)-4-methylsulfanylbutanamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(benzenesulfonamido)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 112789579 |
| Molecular Formula | C23H34N2O3S2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(benzenesulfonamido)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H34N2O3S2/c1-16(23-13-17-10-18(14-23)12-19(11-17)15-23)24-22(26)21(8-9-29-2)25-30(27,28)20-6-4-3-5-7-20/h3-7,16-19,21,25H,8-15H2,1-2H3,(H,24,26) |
| InChIKey | CUZSRINGDQNBNY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |