C19H23ClN2O3S2 — CID 55334688
2-(benzenesulfonamido)-N-[1-(2-chlorophenyl)ethyl]-4-methylsulfanylbutanamide (PubChem CID 55334688) has the molecular formula C19H23ClN2O3S2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[1-(2-chlorophenyl)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-[1-(2-chlorophenyl)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 55334688 |
| Molecular Formula | C19H23ClN2O3S2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[1-(2-chlorophenyl)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NS(=O)(=O)c1ccccc1)C(=O)NC(C)c1ccccc1Cl |
| InChI | InChI=1S/C19H23ClN2O3S2/c1-14(16-10-6-7-11-17(16)20)21-19(23)18(12-13-26-2)22-27(24,25)15-8-4-3-5-9-15/h3-11,14,18,22H,12-13H2,1-2H3,(H,21,23) |
| InChIKey | QMQRIVMYIJZNNU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |