C21H28N2O3S2 — CID 112762191
2-(benzenesulfonamido)-N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanylbutanamide (PubChem CID 112762191) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanylbutanamide.
| Compound Name | 2-(benzenesulfonamido)-N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 112762191 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[1-(4-ethylphenyl)ethyl]-4-methylsulfanylbutanamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(CCSC)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-4-17-10-12-18(13-11-17)16(2)22-21(24)20(14-15-27-3)23-28(25,26)19-8-6-5-7-9-19/h5-13,16,20,23H,4,14-15H2,1-3H3,(H,22,24) |
| InChIKey | ZHOPBDTYOVRWFT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |