C13H20ClN3O5S2 — CID 9180865
4-chloro-N-[(2R)-1-(2,2-dimethylhydrazinyl)-4-methylsulfonyl-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 9180865) has the molecular formula C13H20ClN3O5S2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-(2,2-dimethylhydrazinyl)-4-methylsulfonyl-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-1-(2,2-dimethylhydrazinyl)-4-methylsulfonyl-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 9180865 |
| Molecular Formula | C13H20ClN3O5S2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 4-chloro-N-[(2R)-1-(2,2-dimethylhydrazinyl)-4-methylsulfonyl-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CN(C)NC(=O)[C@@H](CCS(C)(=O)=O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClN3O5S2/c1-17(2)15-13(18)12(8-9-23(3,19)20)16-24(21,22)11-6-4-10(14)5-7-11/h4-7,12,16H,8-9H2,1-3H3,(H,15,18)/t12-/m1/s1 |
| InChIKey | ANDZDVWZWNUKGN-GFCCVEGCSA-N |
| XLogP | 0.01 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|