C20H25ClN4O3S2 — CID 3691406
1-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]thiourea (PubChem CID 3691406) has the molecular formula C20H25ClN4O3S2 and a molecular weight of 469.03 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 3691406 |
| Molecular Formula | C20H25ClN4O3S2 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[(2-pentylsulfanylpyridine-3-carbonyl)amino]thiourea |
| SMILES | CCCCCSc1ncccc1C(=O)NNC(=S)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C20H25ClN4O3S2/c1-4-5-6-10-30-19-13(8-7-9-22-19)18(26)24-25-20(29)23-15-12-16(27-2)14(21)11-17(15)28-3/h7-9,11-12H,4-6,10H2,1-3H3,(H,24,26)(H2,23,25,29) |
| InChIKey | BCCRPXZWOZIVMA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|