C12H14ClN3O3S — CID 4948454
N-[(4-chloro-2-nitrophenyl)carbamothioyl]-3-methylbutanamide (PubChem CID 4948454) has the molecular formula C12H14ClN3O3S and a molecular weight of 315.78 g/mol. Its IUPAC name is N-[(4-chloro-2-nitrophenyl)carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[(4-chloro-2-nitrophenyl)carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4948454 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | N-[(4-chloro-2-nitrophenyl)carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN3O3S/c1-7(2)5-11(17)15-12(20)14-9-4-3-8(13)6-10(9)16(18)19/h3-4,6-7H,5H2,1-2H3,(H2,14,15,17,20) |
| InChIKey | BZSNFFHYPAGJSN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|