C22H24N2O2S2 — CID 31841528
3-(2,2-dimethylpropanoylamino)-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31841528) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylamino)-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylamino)-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31841528 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 3-(2,2-dimethylpropanoylamino)-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(C(=O)N(Cc2cccs2)Cc2cccs2)c1 |
| InChI | InChI=1S/C22H24N2O2S2/c1-22(2,3)21(26)23-17-8-4-7-16(13-17)20(25)24(14-18-9-5-11-27-18)15-19-10-6-12-28-19/h4-13H,14-15H2,1-3H3,(H,23,26) |
| InChIKey | FTVFUNWODDVYBK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |