C25H26N2O5S2 — CID 3651898
N-(1,3-benzodioxol-5-ylmethyl)-2-[benzylsulfonyl(prop-2-enyl)amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 3651898) has the molecular formula C25H26N2O5S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[benzylsulfonyl(prop-2-enyl)amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[benzylsulfonyl(prop-2-enyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 3651898 |
| Molecular Formula | C25H26N2O5S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[benzylsulfonyl(prop-2-enyl)amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C25H26N2O5S2/c1-2-12-27(34(29,30)18-20-7-4-3-5-8-20)17-25(28)26(16-22-9-6-13-33-22)15-21-10-11-23-24(14-21)32-19-31-23/h2-11,13-14H,1,12,15-19H2 |
| InChIKey | QDCLENDDMXLWSG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|