C23H27ClN2O4S — CID 3683693
N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-2,2-dimethyl-N-prop-2-enylpropanamide (PubChem CID 3683693) has the molecular formula C23H27ClN2O4S and a molecular weight of 463.00 g/mol. Its IUPAC name is N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-2,2-dimethyl-N-prop-2-enylpropanamide.
| Compound Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-2,2-dimethyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 3683693 |
| Molecular Formula | C23H27ClN2O4S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | N-[2-[1,3-benzodioxol-5-ylmethyl(thiophen-2-ylmethyl)amino]-2-oxoethyl]-3-chloro-2,2-dimethyl-N-prop-2-enylpropanamide |
| SMILES | C=CCN(CC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C23H27ClN2O4S/c1-4-9-25(22(28)23(2,3)15-24)14-21(27)26(13-18-6-5-10-31-18)12-17-7-8-19-20(11-17)30-16-29-19/h4-8,10-11H,1,9,12-16H2,2-3H3 |
| InChIKey | PAEDZJULLHMZDV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|