C29H31ClN4O6S — CID 4099315
2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 4099315) has the molecular formula C29H31ClN4O6S and a molecular weight of 599.11 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 4099315 |
| Molecular Formula | C29H31ClN4O6S |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-(2-methoxyethyl)amino]-N-[2-(1H-indol-3-yl)ethyl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | COCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(C)cc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H31ClN4O6S/c1-21-7-9-22(10-8-21)19-32(14-13-23-18-31-27-6-4-3-5-25(23)27)29(35)20-33(15-16-40-2)41(38,39)24-11-12-26(30)28(17-24)34(36)37/h3-12,17-18,31H,13-16,19-20H2,1-2H3 |
| InChIKey | ICAKPBJFEMSHOJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|