C31H36N4O5S — CID 4216925
2-[(4-acetamidophenyl)sulfonyl-(3-methoxypropyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 4216925) has the molecular formula C31H36N4O5S and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-(3-methoxypropyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-(3-methoxypropyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 4216925 |
| Molecular Formula | C31H36N4O5S |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-(3-methoxypropyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C31H36N4O5S/c1-24(36)33-27-13-15-28(16-14-27)41(38,39)35(18-8-20-40-2)23-31(37)34(22-25-9-4-3-5-10-25)19-17-26-21-32-30-12-7-6-11-29(26)30/h3-7,9-16,21,32H,8,17-20,22-23H2,1-2H3,(H,33,36) |
| InChIKey | QZFUQVXFZFOHRW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|