C31H34FN3O4S — CID 6013626
N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(E)-2-phenylethenyl]sulfonylamino]acetamide (PubChem CID 6013626) has the molecular formula C31H34FN3O4S and a molecular weight of 563.70 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(E)-2-phenylethenyl]sulfonylamino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(E)-2-phenylethenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 6013626 |
| Molecular Formula | C31H34FN3O4S |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]-2-[3-methoxypropyl-[(E)-2-phenylethenyl]sulfonylamino]acetamide |
| SMILES | COCCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(F)cc1)S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C31H34FN3O4S/c1-39-20-7-18-35(40(37,38)21-17-25-8-3-2-4-9-25)24-31(36)34(23-26-12-14-28(32)15-13-26)19-16-27-22-33-30-11-6-5-10-29(27)30/h2-6,8-15,17,21-22,33H,7,16,18-20,23-24H2,1H3/b21-17+ |
| InChIKey | GHHOYMFREYOZFX-HEHNFIMWSA-N |
| XLogP | 5.22 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|