C28H31N3O3S — CID 3278699
2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 3278699) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 3278699 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-[benzenesulfonyl(propyl)amino]-N-benzyl-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O3S/c1-2-18-31(35(33,34)25-13-7-4-8-14-25)22-28(32)30(21-23-11-5-3-6-12-23)19-17-24-20-29-27-16-10-9-15-26(24)27/h3-16,20,29H,2,17-19,21-22H2,1H3 |
| InChIKey | AVECUEWRKOYGDL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |