C29H28ClF3N4O5S — CID 5081955
2-[(4-chloro-3-nitrophenyl)sulfonyl-propylamino]-N-[2-(1H-indol-3-yl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 5081955) has the molecular formula C29H28ClF3N4O5S and a molecular weight of 637.08 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonyl-propylamino]-N-[2-(1H-indol-3-yl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-propylamino]-N-[2-(1H-indol-3-yl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 5081955 |
| Molecular Formula | C29H28ClF3N4O5S |
| Molecular Weight | 637.08 g/mol |
| Exact Mass | 636.14 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonyl-propylamino]-N-[2-(1H-indol-3-yl)ethyl]-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CCCN(CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H28ClF3N4O5S/c1-2-14-36(43(41,42)23-11-12-25(30)27(16-23)37(39)40)19-28(38)35(18-20-7-9-22(10-8-20)29(31,32)33)15-13-21-17-34-26-6-4-3-5-24(21)26/h3-12,16-17,34H,2,13-15,18-19H2,1H3 |
| InChIKey | LAVOCZIAYJZEJW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 116.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.08 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|