C30H40N2O4S2 — CID 5233204
N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5233204) has the molecular formula C30H40N2O4S2 and a molecular weight of 556.79 g/mol. Its IUPAC name is N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5233204 |
| Molecular Formula | C30H40N2O4S2 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-benzyl-2-[(4-tert-butylphenyl)sulfonyl-(3-ethoxypropyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)S(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H40N2O4S2/c1-6-36-19-10-18-32(38(34,35)27-15-13-26(14-16-27)30(3,4)5)23-29(33)31(21-25-11-8-7-9-12-25)22-28-24(2)17-20-37-28/h7-9,11-17,20H,6,10,18-19,21-23H2,1-5H3 |
| InChIKey | KGIABKPUSRSNFQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|