C28H35N3O5S2 — CID 4565520
2-[(4-acetamidophenyl)sulfonyl-(3-ethoxypropyl)amino]-N-benzyl-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 4565520) has the molecular formula C28H35N3O5S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-(3-ethoxypropyl)amino]-N-benzyl-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-(3-ethoxypropyl)amino]-N-benzyl-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 4565520 |
| Molecular Formula | C28H35N3O5S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-(3-ethoxypropyl)amino]-N-benzyl-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C28H35N3O5S2/c1-4-36-17-8-16-31(38(34,35)26-13-11-25(12-14-26)29-23(3)32)21-28(33)30(19-24-9-6-5-7-10-24)20-27-22(2)15-18-37-27/h5-7,9-15,18H,4,8,16-17,19-21H2,1-3H3,(H,29,32) |
| InChIKey | CRFJUXFCIKMCHI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|