C25H27FN2O2S — CID 4166505
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-propylbenzamide (PubChem CID 4166505) has the molecular formula C25H27FN2O2S and a molecular weight of 438.57 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-propylbenzamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-propylbenzamide |
|---|---|
| PubChem CID | 4166505 |
| Molecular Formula | C25H27FN2O2S |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-3-fluoro-N-propylbenzamide |
| SMILES | CCCN(CC(=O)N(Cc1ccccc1)Cc1sccc1C)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H27FN2O2S/c1-3-13-27(25(30)21-10-7-11-22(26)15-21)18-24(29)28(16-20-8-5-4-6-9-20)17-23-19(2)12-14-31-23/h4-12,14-15H,3,13,16-18H2,1-2H3 |
| InChIKey | NTFADPJQRCXDBM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |