C29H35FN2O3S — CID 3649572
4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-propylbenzamide (PubChem CID 3649572) has the molecular formula C29H35FN2O3S and a molecular weight of 510.68 g/mol. Its IUPAC name is 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-propylbenzamide.
| Compound Name | 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-propylbenzamide |
|---|---|
| PubChem CID | 3649572 |
| Molecular Formula | C29H35FN2O3S |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 4-butoxy-N-[2-[(4-fluorophenyl)methyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-propylbenzamide |
| SMILES | CCCCOc1ccc(C(=O)N(CCC)CC(=O)N(Cc2ccc(F)cc2)Cc2sccc2C)cc1 |
| InChI | InChI=1S/C29H35FN2O3S/c1-4-6-17-35-26-13-9-24(10-14-26)29(34)31(16-5-2)21-28(33)32(20-27-22(3)15-18-36-27)19-23-7-11-25(30)12-8-23/h7-15,18H,4-6,16-17,19-21H2,1-3H3 |
| InChIKey | IXMAKSALYSFJNL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|