C23H32FN3O3S — CID 3644659
2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 3644659) has the molecular formula C23H32FN3O3S and a molecular weight of 449.59 g/mol. Its IUPAC name is 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3644659 |
| Molecular Formula | C23H32FN3O3S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 2-[butylcarbamoyl(2-methoxyethyl)amino]-N-[(4-fluorophenyl)methyl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCCCNC(=O)N(CCOC)CC(=O)N(Cc1ccc(F)cc1)Cc1sccc1C |
| InChI | InChI=1S/C23H32FN3O3S/c1-4-5-11-25-23(29)26(12-13-30-3)17-22(28)27(16-21-18(2)10-14-31-21)15-19-6-8-20(24)9-7-19/h6-10,14H,4-5,11-13,15-17H2,1-3H3,(H,25,29) |
| InChIKey | FHYGKXWSMBNCQT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|