C15H12N2O8S — CID 50894406
2-[carboxymethyl-(2-nitrophenyl)sulfonylamino]benzoic acid (PubChem CID 50894406) has the molecular formula C15H12N2O8S and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[carboxymethyl-(2-nitrophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[carboxymethyl-(2-nitrophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50894406 |
| Molecular Formula | C15H12N2O8S |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 2-[carboxymethyl-(2-nitrophenyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)CN(c1ccccc1C(=O)O)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H12N2O8S/c18-14(19)9-16(11-6-2-1-5-10(11)15(20)21)26(24,25)13-8-4-3-7-12(13)17(22)23/h1-8H,9H2,(H,18,19)(H,20,21) |
| InChIKey | WPAZJCKWABFCMV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|