C14H11Cl3N4O5S — CID 50895365
N-(2-hydrazinyl-2-oxoethyl)-2-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide (PubChem CID 50895365) has the molecular formula C14H11Cl3N4O5S and a molecular weight of 453.69 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-2-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-2-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50895365 |
| Molecular Formula | C14H11Cl3N4O5S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-2-nitro-N-(2,4,5-trichlorophenyl)benzenesulfonamide |
| SMILES | NNC(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H11Cl3N4O5S/c15-8-5-10(17)12(6-9(8)16)20(7-14(22)19-18)27(25,26)13-4-2-1-3-11(13)21(23)24/h1-6H,7,18H2,(H,19,22) |
| InChIKey | UHHLLDFXATXLDA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|