C10H12Cl3N3O3S — CID 50895823
N-(2-hydrazinyl-2-oxoethyl)-N-(2,4,5-trichlorophenyl)ethanesulfonamide (PubChem CID 50895823) has the molecular formula C10H12Cl3N3O3S and a molecular weight of 360.65 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-N-(2,4,5-trichlorophenyl)ethanesulfonamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-N-(2,4,5-trichlorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 50895823 |
| Molecular Formula | C10H12Cl3N3O3S |
| Molecular Weight | 360.65 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-N-(2,4,5-trichlorophenyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(CC(=O)NN)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl3N3O3S/c1-2-20(18,19)16(5-10(17)15-14)9-4-7(12)6(11)3-8(9)13/h3-4H,2,5,14H2,1H3,(H,15,17) |
| InChIKey | PWMMFWUMSKIKRN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|